Name | 3-fluoro-4-nitropyridine 1-oxide |
Synonyms | 3-fluoro-4-nitro-, 1-oxide FLUORO-4-NITROPYRIDINE N-OXIDE 3-fluoro-4-nitro-1-pyridin-1-one 3-FLUORO-4-NITROPYRIDINE-N-OXIDE 3-fluoro-4-nitropyridine 1-oxide 3-fluoro-4-nitro-1-oxidopyridin-1-ium 3-fluoro-4-nitropyridin-1-ium-1-olate |
CAS | 769-54-0 |
EINECS | 813-990-1 |
InChI | InChI=1/C5H3FN2O3/c6-4-3-7(9)2-1-5(4)8(10)11/h1-3H |
Molecular Formula | C5H3FN2O3 |
Molar Mass | 158.09 |
Density | 1.56 |
Melting Point | 122℃ |
Boling Point | 417.9±25.0 °C(Predicted) |
Flash Point | 206.5°C |
Vapor Presure | 8.3E-07mmHg at 25°C |
pKa | -2.08±0.10(Predicted) |
Storage Condition | Sealed in dry,Store in freezer, under -20°C |
Refractive Index | 1.576 |
Use | 3-fluoro-n-oxo-4-nitropyridine is a heterocyclic derivative, it is an important intermediate for the synthesis of novel pesticides and medicines containing pyridine groups. |
synthesis method | using 3-fluoropyridine as the starting material, 3-fluoro-n-oxo-4-nitropyridine was synthesized by N-oxidation and nitration. The synthesis reaction formula is as follows: |